Other Solvents
Filtered Search Results
Carbon Disulfide, ULTRA RESI-ANALYZED™, J.T. Baker™
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
Carbon disulfide, 99.9%, for spectroscopy
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 MDL Number: MFCD00011321 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| MDL Number | MFCD00011321 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
Carbon Disulfide, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
Carbon Disulfide, Reagent Grade, ≥99.9%, Low benzene, Solstice
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 MDL Number: MFCD00011321 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| MDL Number | MFCD00011321 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
Nitromethane-d3, for NMR, 99 atom % D
CAS: 13031-32-8 Molecular Formula: CH3NO2 Molecular Weight (g/mol): 64.06 MDL Number: MFCD00044214 InChI Key: LYGJENNIWJXYER-FIBGUPNXSA-N Synonym: nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms PubChem CID: 123293 IUPAC Name: trideuterio(nitro)methane SMILES: [2H]C([2H])([2H])[N+]([O-])=O
| PubChem CID | 123293 |
|---|---|
| CAS | 13031-32-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00044214 |
| SMILES | [2H]C([2H])([2H])[N+]([O-])=O |
| Synonym | nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms |
| IUPAC Name | trideuterio(nitro)methane |
| InChI Key | LYGJENNIWJXYER-FIBGUPNXSA-N |
| Molecular Formula | CH3NO2 |
Dimethyl Sulfoxide-d6, 99.9 Atom% D, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
D2493, 2206-27-1, CD3SOCD3
| Percent Purity | 99.9% |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 87.14 |
| Color | Colorless |
| Packaging | Ampule |
| Chemical Name or Material | Dimethyl Sulfoxide to d6, 99.9 Atom Percent D |
| Grade | Ungraded |
| CAS Max % | 100% |
Dimethylformamide - D7, deuteration degree min. 99.5% for NMR spectroscopy MagniSolv™, MilliporeSigma™
CAS: 4472-41-7 Molecular Formula: C3H7NO Molecular Weight (g/mol): 80.138 InChI Key: ZMXDDKWLCZADIW-YYWVXINBSA-N Synonym: n,n-dimethylformamide-d7,dmf-d7,deuterated dmf,n,n-di 2h3 methyl 2h formamide,dimethyl formamide-d7,dimethylformamide d,heptadeutero-n,n-dimethylformamide,n,n-dimethylformamide-d7 dmf-d7,formamide-1-d, n,n-di methyl-d3,n,n-dimethylformamide-d7 99.5atom%d PubChem CID: 78225 IUPAC Name: 1-deuterio-N,N-bis(trideuteriomethyl)formamide SMILES: CN(C)C=O
| PubChem CID | 78225 |
|---|---|
| CAS | 4472-41-7 |
| Molecular Weight (g/mol) | 80.138 |
| SMILES | CN(C)C=O |
| Synonym | n,n-dimethylformamide-d7,dmf-d7,deuterated dmf,n,n-di 2h3 methyl 2h formamide,dimethyl formamide-d7,dimethylformamide d,heptadeutero-n,n-dimethylformamide,n,n-dimethylformamide-d7 dmf-d7,formamide-1-d, n,n-di methyl-d3,n,n-dimethylformamide-d7 99.5atom%d |
| IUPAC Name | 1-deuterio-N,N-bis(trideuteriomethyl)formamide |
| InChI Key | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| Molecular Formula | C3H7NO |
Chloroform-d, 99.8% (Isotopic)
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
N,N-Dimethylacetamide-d{9}, 99% (Isotopic)
CAS: 116057-81-9 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00066061 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: n,n-dimethylacetamide-d9,n,n-bis ∼2∼h_3_ methyl ∼2∼h_3_ acetamide,an,n-dimethylacetamide-d9,n,n-dimethylacetamide-d9, 99 atom % d,n,n-bis 2 h? methyl 2 h? acetamide,n,n-di 2 h? methyl 2 h? acetamide PubChem CID: 22789542 SMILES: CN(C)C(C)=O
| PubChem CID | 22789542 |
|---|---|
| CAS | 116057-81-9 |
| Molecular Weight (g/mol) | 87.12 |
| MDL Number | MFCD00066061 |
| SMILES | CN(C)C(C)=O |
| Synonym | n,n-dimethylacetamide-d9,n,n-bis ∼2∼h_3_ methyl ∼2∼h_3_ acetamide,an,n-dimethylacetamide-d9,n,n-dimethylacetamide-d9, 99 atom % d,n,n-bis 2 h? methyl 2 h? acetamide,n,n-di 2 h? methyl 2 h? acetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
2,2,4-Trimethylpentane, 99.5%, Extra Dry, AcroSeal™
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
EcoLite(+) Scintillation Cocktail, MP Biomedicals
All Purpose, Environmentally Safe, Biodegradable, Non-Toxic, Non-Flammable, Ready-to-Use, For RIA and Receptor Assays, Forms no gel or phasing
| Chemical Name or Material | EcoLite(+)™ Liquid Scintillation Cocktail |
|---|
Acetone-d6, for NMR, packaged in 0.75 ml ampoules, 99.5 atom % D
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 MDL Number: MFCD00044635 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| MDL Number | MFCD00044635 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
2-Propanol-d{8}, 99%(Isotopic)
CAS: 22739-76-0 Molecular Formula: C3H8O Molecular Weight (g/mol): 68.15 MDL Number: MFCD00044341 InChI Key: KFZMGEQAYNKOFK-PIODKIDGSA-N Synonym: 2-propanol-d8,isopropanol-d8,2 h? propan-2-2 h ol,octadeuteroisopropanol,2h8-2-propanol,2-propan-1,1,1,2,3,3,3-d7-ol-d,2-propanol-d isotopic 1g,2-propanol-d8, 99.5 atom % d PubChem CID: 2723972 SMILES: [2H]OC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H]
| PubChem CID | 2723972 |
|---|---|
| CAS | 22739-76-0 |
| Molecular Weight (g/mol) | 68.15 |
| MDL Number | MFCD00044341 |
| SMILES | [2H]OC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Synonym | 2-propanol-d8,isopropanol-d8,2 h? propan-2-2 h ol,octadeuteroisopropanol,2h8-2-propanol,2-propan-1,1,1,2,3,3,3-d7-ol-d,2-propanol-d isotopic 1g,2-propanol-d8, 99.5 atom % d |
| InChI Key | KFZMGEQAYNKOFK-PIODKIDGSA-N |
| Molecular Formula | C3H8O |
Methanol-d{4}, 100%(Isotopic)
CAS: 811-98-3 Molecular Formula: CH4O Molecular Weight (g/mol): 36.066 MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC Name: trideuterio(deuteriooxy)methane SMILES: CO
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| Molecular Weight (g/mol) | 36.066 |
| MDL Number | MFCD00044637 |
| SMILES | CO |
| Synonym | methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d |
| IUPAC Name | trideuterio(deuteriooxy)methane |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
Nitromethane-d{3}, 99%(Isotopic), Thermo Scientific Chemicals
CAS: 13031-32-8 Molecular Formula: CH3NO2 Molecular Weight (g/mol): 64.06 MDL Number: MFCD00044214 InChI Key: LYGJENNIWJXYER-FIBGUPNXSA-N Synonym: nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms PubChem CID: 123293 IUPAC Name: trideuterio(nitro)methane SMILES: [2H]C([2H])([2H])[N+]([O-])=O
| PubChem CID | 123293 |
|---|---|
| CAS | 13031-32-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00044214 |
| SMILES | [2H]C([2H])([2H])[N+]([O-])=O |
| Synonym | nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms |
| IUPAC Name | trideuterio(nitro)methane |
| InChI Key | LYGJENNIWJXYER-FIBGUPNXSA-N |
| Molecular Formula | CH3NO2 |